* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | HLI 373 |
CAS: | 960045-51-6 ;502137-98-6 |
English Synonyms: | HDM2 INHIBITOR ; HLI 373 |
MDL Number.: | MFCD16875714 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cn1c(=O)c-2c(c3ccccc3[nH]c2nc1=O)NCCCN(C)C.Cl |
InChi: | InChI=1S/C17H21N5O2.ClH/c1-21(2)10-6-9-18-14-11-7-4-5-8-12(11)19-15-13(14)16(23)22(3)17(24)20-15;/h4-5,7-8H,6,9-10H2,1-3H3,(H2,18,19,20,24);1H |
InChiKey: | InChIKey=CLVSUKBVKIHIOA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.