* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(PYRIDIN-3-YL)-3,4-DIHYDROPYRIMIDIN-4-ONE |
CAS: | 97604-06-3 |
English Synonyms: | ABBYPHARMA AP-10-1465 ; 2-(PYRIDIN-3-YL)-3,4-DIHYDROPYRIMIDIN-4-ONE |
MDL Number.: | MFCD12107647 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(cnc1)c2[nH]c(=O)ccn2 |
InChi: | InChI=1S/C9H7N3O/c13-8-3-5-11-9(12-8)7-2-1-4-10-6-7/h1-6H,(H,11,12,13) |
InChiKey: | InChIKey=RBYRTULDUOUZQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.