* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-BETANA |
| CAS: | 97948-70-4 |
| English Synonyms: | Z-ALA-BETANA |
| MDL Number.: | MFCD00155569 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | C[C@@H](C(=O)Nc1ccc2ccccc2c1)NC(=O)OCc3ccccc3 |
| InChi: | InChI=1S/C21H20N2O3/c1-15(22-21(25)26-14-16-7-3-2-4-8-16)20(24)23-19-12-11-17-9-5-6-10-18(17)13-19/h2-13,15H,14H2,1H3,(H,22,25)(H,23,24)/t15-/m0/s1 |
| InChiKey: | InChIKey=PTRXMEBOWZBSJT-HNNXBMFYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.