* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CIS-1-((2-(5-CHLORO-2-BENZOFURANYL)-4-ETHYL-1,3-DIOXOLAN-2-YL)METHYL)-1H-1,2,4-TRIAZOLE |
| CAS: | 98519-06-3 |
| English Synonyms: | CIS-1-((2-(5-CHLORO-2-BENZOFURANYL)-4-ETHYL-1,3-DIOXOLAN-2-YL)METHYL)-1H-1,2,4-TRIAZOLE |
| MDL Number.: | MFCD01761054 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC[C@H]1CO[C@@](O1)(Cn2cncn2)c3cc4cc(ccc4o3)Cl |
| InChi: | InChI=1S/C16H16ClN3O3/c1-2-13-7-21-16(23-13,8-20-10-18-9-19-20)15-6-11-5-12(17)3-4-14(11)22-15/h3-6,9-10,13H,2,7-8H2,1H3/t13-,16+/m0/s1 |
| InChiKey: | InChIKey=GKGMLPKHSHONGE-XJKSGUPXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.