* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | K-252B |
| CAS: | 99570-78-2 |
| English Synonyms: | PROTEIN KINASE INHIBITOR K-252B ; K-252B, NOCARDIOPSIS SP ; (9R,10S,12S)-2,3,9,10,11,12-HEXAHYDRO-10-HYDROXY-9-METHYL-1-OXO-9,12-EPOXY-1H-DIINDOLO[1,2,3-FG:3',2',1'-KL]PYRROLO[3,4-I][1,6]BENZODIAZOCINE-10-CARBOXYLIC ACID ; K-252B |
| MDL Number.: | MFCD09878299 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | C[C@]12[C@@](C[C@H](O1)n3c4ccccc4c5c3c6n2c7ccccc7c6c8c5C(=O)NC8)(C(=O)O)O |
| InChi: | InChI=1S/C26H19N3O5/c1-25-26(33,24(31)32)10-17(34-25)28-15-8-4-2-6-12(15)19-20-14(11-27-23(20)30)18-13-7-3-5-9-16(13)29(25)22(18)21(19)28/h2-9,17,33H,10-11H2,1H3,(H,27,30)(H,31,32)/t17-,25+,26+/m0/s1 |
| InChiKey: | InChIKey=AMSOPBXQXSAAAC-RBWOYHBQSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.