
Basic Information

CAS: 52147-67-8
MDL Number.: MFCD00002092
H bond acceptor: 3
H bond donor: 0
Smile: CS(=O)CC(=O)OC
InChi: InChI=1S/C4H8O3S/c1-7-4(5)3-8(2)6/h3H2,1-2H3


Safety information