80866-89-3 ;379-34-0
C12 H12 N2 O4

Basic Information

CAS: 80866-89-3 ;379-34-0
MDL Number.: MFCD00006668
H bond acceptor: 6
H bond donor: 3
Smile: CCC1(C(=O)NC(=O)NC1=O)c2ccc(cc2)O
InChi: InChI=1S/C12H12N2O4/c1-2-12(7-3-5-8(15)6-4-7)9(16)13-11(18)14-10(12)17/h3-6,15H,2H2,1H3,(H2,13,14,16,17,18)


Safety information

WGK Germany: 3