C7 H8 N2 O3 S

Basic Information

CAS: 64987-08-2
MDL Number.: MFCD00010414
H bond acceptor: 5
H bond donor: 1
Smile: CCOC(=O)C(=O)c1csc(n1)N
InChi: InChI=1S/C7H8N2O3S/c1-2-12-6(11)5(10)4-3-13-7(8)9-4/h3H,2H2,1H3,(H2,8,9)


Safety information