C8 H4 Cl N O2

Basic Information

CAS: 5100-23-2
MDL Number.: MFCD00010810
H bond acceptor: 3
H bond donor: 0
Smile: c1ccc(c(c1)C(=O)Cl)N=C=O
InChi: InChI=1S/C8H4ClNO2/c9-8(12)6-3-1-2-4-7(6)10-5-11/h1-4H