C6 H6 As N O

Basic Information

CAS: 1122-90-3
MDL Number.: MFCD00012403
H bond acceptor: 2
H bond donor: 1
Smile: c1cc(ccc1N)[As]=O
InChi: InChI=1S/C6H6AsNO/c8-6-3-1-5(7-9)2-4-6/h1-4H,8H2