C10 H9 N O2 S2

Basic Information

CAS: 56676-49-4
MDL Number.: MFCD00022550
H bond acceptor: 3
H bond donor: 0
Smile: COc1ccccc1N2C(=O)CSC2=S
InChi: InChI=1S/C10H9NO2S2/c1-13-8-5-3-2-4-7(8)11-9(12)6-15-10(11)14/h2-5H,6H2,1H3