C9 H11 N O2

Basic Information

CAS: 52414-95-6
MDL Number.: MFCD00024535
H bond acceptor: 3
H bond donor: 0
Smile: Cc1cc(cc(c1C)C)[N+](=O)[O-]
InChi: InChI=1S/C9H11NO2/c1-6-4-9(10(11)12)5-7(2)8(6)3/h4-5H,1-3H3