C13 H9 Cl N2 O3

Basic Information

CAS: 55501-45-6
MDL Number.: MFCD00024620
H bond acceptor: 5
H bond donor: 1
Smile: c1ccc(c(c1)C(=O)Nc2ccc(cc2)[N+](=O)[O-])Cl
InChi: InChI=1S/C13H9ClN2O3/c14-12-4-2-1-3-11(12)13(17)15-9-5-7-10(8-6-9)16(18)19/h1-8H,(H,15,17)