C16 H15 N O2 S

Basic Information

CAS: 56048-61-4
MDL Number.: MFCD00030230
H bond acceptor: 3
H bond donor: 0
Smile: CCOc1ccc(cc1OC)c2nc3ccccc3s2
InChi: InChI=1S/C16H15NO2S/c1-3-19-13-9-8-11(10-14(13)18-2)16-17-12-6-4-5-7-15(12)20-16/h4-10H,3H2,1-2H3