C12 H9 O2 P

Basic Information

CAS: 35948-25-5
MDL Number.: MFCD00040561
H bond acceptor: 2
H bond donor: 0
Smile: c1ccc2c(c1)-c3ccccc3P(=O)O2
InChi: InChI=1S/C12H9O2P/c13-15-12-8-4-2-6-10(12)9-5-1-3-7-11(9)14-15/h1-8,15H


Melting Point: 119 °C

Safety information