C8 H9 I


CAS: 31599-61-8
pro_mdlNumber: MFCD00040989
pro_acceptors: 0
pro_donors: 0
pro_smile: Cc1ccc(cc1C)I
InChi: InChI=1S/C8H9I/c1-6-3-4-8(9)5-7(6)2/h3-5H,1-2H3


Boiling_Point: 106-108 DEG C/13 MMHG(LIT)/106-108°C/106-108°C
Density: 1.633g/mLat25°C(lit.)
PhysicalProperty: FLASHPOINT: 113 DEG C
Comments: UNSPSC: 12352100
WGK: 3


secure_symbol: GHS07 GHS07
secure_signal_word: Warning
secure_risk_stmt: H315-H319-H335
secure_cautionary_stmt: P261-P305 + P351 + P338
secure_damage_code: Xi
secure_risk_disclosure_stmt: R:36/37/38
secure_security_stmt: S:26-36
secure_wgk_germany: 3
secure_flash_point: 113 °C/113 °C

* If the product has intellectual property rights, a license granted is must or contact us.