C3 H5 F O3

Basic Information

CAS: 433-47-6
MDL Number.: MFCD00055922
H bond acceptor: 3
H bond donor: 2
Smile: C(C(C(=O)O)O)F
InChi: InChI=1S/C3H5FO3/c4-1-2(5)3(6)7/h2,5H,1H2,(H,6,7)