C9 H14 N2

Basic Information

CAS: 36075-06-6
MDL Number.: MFCD00059777
H bond acceptor: 2
H bond donor: 0
Smile: CCN(CC)c1ccccn1
InChi: InChI=1S/C9H14N2/c1-3-11(4-2)9-7-5-6-8-10-9/h5-8H,3-4H2,1-2H3


Density: DENSITY: 0.97

Safety information