C14 H16 N4 O

Basic Information

CAS: 6232-57-1
MDL Number.: MFCD00059857
H bond acceptor: 5
H bond donor: 2
Smile: Cc1cc(c(cc1/N=N/c2ccc(cc2)N)OC)N
InChi: InChI=1S/C14H16N4O/c1-9-7-12(16)14(19-2)8-13(9)18-17-11-5-3-10(15)4-6-11/h3-8H,15-16H2,1-2H3/b18-17+


Safety information