C14 H28 O

Basic Information

CAS: 2345-27-9
MDL Number.: MFCD00060927
H bond acceptor: 1
H bond donor: 0
InChi: InChI=1S/C14H28O/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h3-13H2,1-2H3


Safety information