C11 H14 N2 O2

Basic Information

CAS: 90-49-3
MDL Number.: MFCD00069050
H bond acceptor: 4
H bond donor: 2
Smile: CCC(c1ccccc1)C(=O)NC(=O)N
InChi: InChI=1S/C11H14N2O2/c1-2-9(10(14)13-11(12)15)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H3,12,13,14,15)