7667-60-9 ;1678-80-4
C9 H18

Basic Information

CAS: 7667-60-9 ;1678-80-4
MDL Number.: MFCD00070702
H bond acceptor: 0
H bond donor: 0
Smile: C[C@H]1CC[C@@H]([C@H](C1)C)C
InChi: InChI=1S/C9H18/c1-7-4-5-8(2)9(3)6-7/h7-9H,4-6H2,1-3H3/t7-,8-,9-/m0/s1