C4 H8 N2 O2

Basic Information

CAS: 111821-58-0
MDL Number.: MFCD00078584
H bond acceptor: 4
H bond donor: 2
Smile: C1CN(C(=O)[C@H]1N)O
InChi: InChI=1S/C4H8N2O2/c5-3-1-2-6(8)4(3)7/h3,8H,1-2,5H2/t3-/m0/s1