113715-28-9 ;49837-81-2
C8 H14 N3 O3

Basic Information

CAS: 113715-28-9 ;49837-81-2
MDL Number.: MFCD00143329
H bond acceptor: 6
H bond donor: 1
Smile: CC1(C(=[N+](C(N1[O])(C)C)[O-])/C=N/O)C
InChi: InChI=1S/C8H14N3O3/c1-7(2)6(5-9-12)10(13)8(3,4)11(7)14/h5,12H,1-4H3/b9-5+