C2 O5 V

Basic Information

CAS: 15500-04-6
MDL Number.: MFCD00210381
H bond acceptor: 5
H bond donor: 0
Smile: C1(=O)C(=O)O[V](=O)O1
InChi: InChI=1S/C2H2O4.O.V/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;;+2/p-2