C4 H6 N4 O S

Basic Information

MDL Number.: MFCD00235026
H bond acceptor: 5
H bond donor: 3
Smile: c1(c(nc([nH]c1=O)S)N)N
InChi: InChI=1S/C4H6N4OS/c5-1-2(6)7-4(10)8-3(1)9/h5H2,(H4,6,7,8,9,10)