C8 H13 F N4

Basic Information

CAS: 51421-98-8
MDL Number.: MFCD00457684
H bond acceptor: 4
H bond donor: 0
Smile: CN(C)c1cc(nc(n1)N(C)C)F
InChi: InChI=1S/C8H13FN4/c1-12(2)7-5-6(9)10-8(11-7)13(3)4/h5H,1-4H3


Safety information