C7 H8 N2 O3

Basic Information

CAS: 151606-30-3
MDL Number.: MFCD00467665
H bond acceptor: 5
H bond donor: 2
Smile: CN(c1cc(ccc1O)O)N=O
InChi: InChI=1S/C7H8N2O3/c1-9(8-12)6-4-5(10)2-3-7(6)11/h2-4,10-11H,1H3