C7 H10 N4 O3

Basic Information

CAS: 57966-95-7
MDL Number.: MFCD01102978
H bond acceptor: 7
H bond donor: 2
Smile: CCNC(=O)NC(=O)/C(=N\OC)/C#N
InChi: InChI=1S/C7H10N4O3/c1-3-9-7(13)10-6(12)5(4-8)11-14-2/h3H2,1-2H3,(H2,9,10,12,13)/b11-5-