C41 H50 N6 O2

Basic Information

CAS: 103597-45-1
MDL Number.: MFCD01103222
H bond acceptor: 8
H bond donor: 2
Smile: CC(C)(C)CC(C)(C)c1cc(c(c(c1)n2nc3ccccc3n2)O)Cc4cc(cc(c4O)n5nc6ccccc6n5)C(C)(C)CC(C)(C)C
InChi: InChI=1S/C41H50N6O2/c1-38(2,3)24-40(7,8)28-20-26(36(48)34(22-28)46-42-30-15-11-12-16-31(30)43-46)19-27-21-29(41(9,10)25-39(4,5)6)23-35(37(27)49)47-44-32-17-13-14-18-33(32)45-47/h11-18,20-23,48-49H,19,24-25H2,1-10H3