C14 H10 I2 O4

Basic Information

CAS: 1155-40-4
MDL Number.: MFCD01310871
H bond acceptor: 4
H bond donor: 2
Smile: c1cc(ccc1O)Oc2c(cc(cc2I)CC(=O)O)I
InChi: InChI=1S/C14H10I2O4/c15-11-5-8(7-13(18)19)6-12(16)14(11)20-10-3-1-9(17)2-4-10/h1-6,17H,7H2,(H,18,19)