C10 H13 B O4

Basic Information

CAS: 342002-80-6
MDL Number.: MFCD02093047
H bond acceptor: 4
H bond donor: 2
Smile: B(c1cccc(c1)C(=O)OC(C)C)(O)O
InChi: InChI=1S/C10H13BO4/c1-7(2)15-10(12)8-4-3-5-9(6-8)11(13)14/h3-7,13-14H,1-2H3


Boiling Point: DENSITY: 0.912
Comments: ORIGINAL SKU: CDS015241-100MG

Safety information