C10 H11 B O4

Basic Information

CAS: 380430-59-1
MDL Number.: MFCD02179477
H bond acceptor: 4
H bond donor: 2
Smile: B(c1cccc(c1)/C=C/C(=O)OC)(O)O
InChi: InChI=1S/C10H11BO4/c1-15-10(12)6-5-8-3-2-4-9(7-8)11(13)14/h2-7,13-14H,1H3/b6-5+


Melting Point: 126-130 DEG C
Comments: HAZARD: R 36/37/38
HAZARD: S 26-37-60
UNSPSC: 12000000

Safety information