ETHYL 4-(3,5-DICHLORO-2-METHOXYPHENYL)-2-OXO-6-PHENYL-1,2,3,4-TETRAHYDRO-5-PYRIMIDINECARBOXYLATE

pro_cas
pro_cdbregno
CCD00296389
pro_formula
C20 H18 Cl2 N2 O4
pro_molWeight
421.278

basic_info

Product_Name: ETHYL 4-(3,5-DICHLORO-2-METHOXYPHENYL)-2-OXO-6-PHENYL-1,2,3,4-TETRAHYDRO-5-PYRIMIDINECARBOXYLATE
EnglishSynonyms: ETHYL 4-(3,5-DICHLORO-2-METHOXYPHENYL)-2-OXO-6-PHENYL-1,2,3,4-TETRAHYDRO-5-PYRIMIDINECARBOXYLATE
pro_mdlNumber: MFCD02182545
pro_acceptors: 6
pro_donors: 2
pro_smile: CCOC(=O)C1=C(NC(=O)NC1c2cc(cc(c2OC)Cl)Cl)c3ccccc3
InChi: InChI=1S/C20H18Cl2N2O4/c1-3-28-19(25)15-16(11-7-5-4-6-8-11)23-20(26)24-17(15)13-9-12(21)10-14(22)18(13)27-2/h4-10,17H,3H2,1-2H3,(H2,23,24,26)
InChiKey: InChIKey=MDFAOSQQIXUPKB-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.