C8 H6 Cl F O

Basic Information

CAS: 111991-24-3
MDL Number.: MFCD02261733
H bond acceptor: 1
H bond donor: 0
Smile: c1cc(c(c(c1)Cl)CC=O)F
InChi: InChI=1S/C8H6ClFO/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3,5H,4H2