C8 H11 B O3 S

Basic Information

CAS: 1072952-07-8
MDL Number.: MFCD03092933
H bond acceptor: 3
H bond donor: 2
Smile: B(c1cccc(c1)S(=O)CC)(O)O
InChi: InChI=1S/C8H11BO3S/c1-2-13(12)8-5-3-4-7(6-8)9(10)11/h3-6,10-11H,2H2,1H3


Comments: ORIGINAL SKU: CDS010342-25MG

Safety information