C9 H6 F N O

Basic Information

CAS: 126921-16-2
MDL Number.: MFCD03095352
H bond acceptor: 2
H bond donor: 1
Smile: c1cc2c(c[nH]c2c(c1)F)C=O
InChi: InChI=1S/C9H6FNO/c10-8-3-1-2-7-6(5-12)4-11-9(7)8/h1-5,11H