C5 H5 B Br N O2

Basic Information

CAS: 223463-14-7
MDL Number.: MFCD03411558
H bond acceptor: 3
H bond donor: 2
Smile: B(c1ccc(nc1)Br)(O)O
InChi: InChI=1S/C5H5BBrNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3,9-10H


Melting Point: 161-166 DEG C/165°
UNSPSC: 12352103
WGK: 3

Safety information

WGK Germany: 3