C10 H13 N O2

Basic Information

CAS: 5472-70-8
MDL Number.: MFCD05227937
H bond acceptor: 3
H bond donor: 2
Smile: Cc1cccc(c1)CC(C(=O)O)N
InChi: InChI=1S/C10H13NO2/c1-7-3-2-4-8(5-7)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)