C13 H29 B O2

Basic Information

MDL Number.: MFCD06201028
H bond acceptor: 2
H bond donor: 2
InChi: InChI=1S/C13H29BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h15-16H,2-13H2,1H3