42821-92-1 ;28485-17-8
C6 H6 N2 O4

Basic Information

CAS: 42821-92-1 ;28485-17-8
MDL Number.: MFCD06203889
H bond acceptor: 6
H bond donor: 2
Smile: COC(=O)c1c[nH]c(=O)[nH]c1=O
InChi: InChI=1S/C6H6N2O4/c1-12-5(10)3-2-7-6(11)8-4(3)9/h2H,1H3,(H2,7,8,9,11)