AURORA KA-5154

pro_cas
pro_cdbregno
CCD00547663
pro_formula
C22H15N5O5
pro_molWeight
429.391

basic_info

Product_Name: AURORA KA-5154
EnglishSynonyms: AURORA KA-5154
pro_mdlNumber: MFCD06653785
pro_acceptors: 10
pro_donors: 0
pro_smile: CN1C(=O)N(C)C2=C(C1=O)C1=C(C=C3C=CC(=CC3=N1)[N+]([O-])=O)C(=O)N2C1=CC=CC=C1
InChi: InChI=1S/C22H15N5O5/c1-24-19-17(21(29)25(2)22(24)30)18-15(20(28)26(19)13-6-4-3-5-7-13)10-12-8-9-14(27(31)32)11-16(12)23-18/h3-11H,1-2H3
InChiKey: InChIKey=BUDIOYWCNKJWJI-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.