C15 H17 N O2 S

Basic Information

CAS: 852388-79-5
MDL Number.: MFCD06655417
H bond acceptor: 3
H bond donor: 1
Smile: c1ccc2c(c1)nc(s2)CC3(CCCC3)CC(=O)O
InChi: InChI=1S/C15H17NO2S/c17-14(18)10-15(7-3-4-8-15)9-13-16-11-5-1-2-6-12(11)19-13/h1-2,5-6H,3-4,7-10H2,(H,17,18)