C10 H10 N4 O

Basic Information

CAS: 852388-83-1
MDL Number.: MFCD06655421
H bond acceptor: 5
H bond donor: 2
Smile: c1ccc(cc1)n2cncc2C(=O)NN
InChi: InChI=1S/C10H10N4O/c11-13-10(15)9-6-12-7-14(9)8-4-2-1-3-5-8/h1-7H,11H2,(H,13,15)