C12 H14 Cl N O3 S

Basic Information

CAS: 852388-73-9
MDL Number.: MFCD06655427
H bond acceptor: 4
H bond donor: 0
Smile: CC1Cc2cc(ccc2N1S(=O)(=O)C)C(=O)CCl
InChi: InChI=1S/C12H14ClNO3S/c1-8-5-10-6-9(12(15)7-13)3-4-11(10)14(8)18(2,16)17/h3-4,6,8H,5,7H2,1-2H3