C8 H5 Br N2 O

Basic Information

CAS: 887593-99-9
MDL Number.: MFCD06656809
H bond acceptor: 3
H bond donor: 0
Smile: c1cc(c(nc1)Br)C(=O)CC#N
InChi: InChI=1S/C8H5BrN2O/c9-8-6(2-1-5-11-8)7(12)3-4-10/h1-2,5H,3H2