C10 H7 N O2 S

Basic Information

CAS: 885278-87-5
MDL Number.: MFCD06738378
H bond acceptor: 3
H bond donor: 1
Smile: c1cc(ccc1c2nc(cs2)C=O)O
InChi: InChI=1S/C10H7NO2S/c12-5-8-6-14-10(11-8)7-1-3-9(13)4-2-7/h1-6,13H