C8 H17 N3

Basic Information

CAS: 847572-30-9
MDL Number.: MFCD06740184
H bond acceptor: 3
H bond donor: 3
Smile: C1CCCC(CC1)NC(=N)N
InChi: InChI=1S/C8H17N3/c9-8(10)11-7-5-3-1-2-4-6-7/h7H,1-6H2,(H4,9,10,11)


Safety information