C8 H15 B O2

Basic Information

CAS: 865869-28-9
MDL Number.: MFCD07363758
H bond acceptor: 2
H bond donor: 2
Smile: B(C1=CCC(CC1)(C)C)(O)O
InChi: InChI=1S/C8H15BO2/c1-8(2)5-3-7(4-6-8)9(10)11/h3,10-11H,4-6H2,1-2H3


Comments: ORIGINAL SKU: CDS016285-50MG

Safety information

WGK Germany: 3