C8 H6 F2 O3

Basic Information

CAS: 887587-75-9
MDL Number.: MFCD07368159
H bond acceptor: 3
H bond donor: 2
Smile: c1cc(c(c(c1CC(=O)O)F)F)O
InChi: InChI=1S/C8H6F2O3/c9-7-4(3-6(12)13)1-2-5(11)8(7)10/h1-2,11H,3H2,(H,12,13)